C17H18BrN3O4 — CID 8988884
N'-[(Z)-(5-bromo-2-propoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide (PubChem CID 8988884) has the molecular formula C17H18BrN3O4 and a molecular weight of 408.25 g/mol. Its IUPAC name is N'-[(Z)-(5-bromo-2-propoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-(5-bromo-2-propoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 8988884 |
| Molecular Formula | C17H18BrN3O4 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | N'-[(Z)-(5-bromo-2-propoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide |
| SMILES | CCCOc1ccc(Br)cc1/C=N\NC(=O)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H18BrN3O4/c1-2-7-25-15-6-5-13(18)9-12(15)10-20-21-17(23)16(22)19-11-14-4-3-8-24-14/h3-6,8-10H,2,7,11H2,1H3,(H,19,22)(H,21,23)/b20-10- |
| InChIKey | IFFHIBWHSQAULZ-JMIUGGIZSA-N |
| XLogP | 2.60 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|