C16H16N2O5 — CID 3122901
ethyl 4-[[2-(furan-2-ylmethylamino)-2-oxoacetyl]amino]benzoate (PubChem CID 3122901) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is ethyl 4-[[2-(furan-2-ylmethylamino)-2-oxoacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(furan-2-ylmethylamino)-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 3122901 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | ethyl 4-[[2-(furan-2-ylmethylamino)-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C16H16N2O5/c1-2-22-16(21)11-5-7-12(8-6-11)18-15(20)14(19)17-10-13-4-3-9-23-13/h3-9H,2,10H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | CGLGUTFZUMBDLK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|