C18H22N2O5 — CID 42944313
ethyl 4-[[2-(furan-2-ylmethyl)-3-hydroxypropyl]carbamoylamino]benzoate (PubChem CID 42944313) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is ethyl 4-[[2-(furan-2-ylmethyl)-3-hydroxypropyl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[2-(furan-2-ylmethyl)-3-hydroxypropyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 42944313 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | ethyl 4-[[2-(furan-2-ylmethyl)-3-hydroxypropyl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)NCC(CO)Cc2ccco2)cc1 |
| InChI | InChI=1S/C18H22N2O5/c1-2-24-17(22)14-5-7-15(8-6-14)20-18(23)19-11-13(12-21)10-16-4-3-9-25-16/h3-9,13,21H,2,10-12H2,1H3,(H2,19,20,23) |
| InChIKey | IOYYFVVOIODRGX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |