C15H17N3O5 — CID 42944308
1-[2-(furan-2-ylmethyl)-3-hydroxypropyl]-3-(4-nitrophenyl)urea (PubChem CID 42944308) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-[2-(furan-2-ylmethyl)-3-hydroxypropyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[2-(furan-2-ylmethyl)-3-hydroxypropyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 42944308 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-[2-(furan-2-ylmethyl)-3-hydroxypropyl]-3-(4-nitrophenyl)urea |
| SMILES | O=C(NCC(CO)Cc1ccco1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H17N3O5/c19-10-11(8-14-2-1-7-23-14)9-16-15(20)17-12-3-5-13(6-4-12)18(21)22/h1-7,11,19H,8-10H2,(H2,16,17,20) |
| InChIKey | GLUSFDGRLIRRBQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|