C22H17Cl2N3O5 — CID 2272375
ethyl 4-[[2-[2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate (PubChem CID 2272375) has the molecular formula C22H17Cl2N3O5 and a molecular weight of 474.30 g/mol. Its IUPAC name is ethyl 4-[[2-[2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2272375 |
| Molecular Formula | C22H17Cl2N3O5 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | ethyl 4-[[2-[2-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=O)NN=Cc2ccc(-c3ccc(Cl)c(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C22H17Cl2N3O5/c1-2-31-22(30)13-3-6-15(7-4-13)26-20(28)21(29)27-25-12-16-8-10-19(32-16)14-5-9-17(23)18(24)11-14/h3-12H,2H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | CLJDEZPHXACMML-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|