C21H18ClN3O4 — CID 21370945
ethyl 5-[5-[(E)-[(2-aminobenzoyl)hydrazinylidene]methyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 21370945) has the molecular formula C21H18ClN3O4 and a molecular weight of 411.85 g/mol. Its IUPAC name is ethyl 5-[5-[(E)-[(2-aminobenzoyl)hydrazinylidene]methyl]furan-2-yl]-2-chlorobenzoate.
| Compound Name | ethyl 5-[5-[(E)-[(2-aminobenzoyl)hydrazinylidene]methyl]furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 21370945 |
| Molecular Formula | C21H18ClN3O4 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | ethyl 5-[5-[(E)-[(2-aminobenzoyl)hydrazinylidene]methyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1cc(-c2ccc(/C=N/NC(=O)c3ccccc3N)o2)ccc1Cl |
| InChI | InChI=1S/C21H18ClN3O4/c1-2-28-21(27)16-11-13(7-9-17(16)22)19-10-8-14(29-19)12-24-25-20(26)15-5-3-4-6-18(15)23/h3-12H,2,23H2,1H3,(H,25,26)/b24-12+ |
| InChIKey | GJYRGZSHVFYXRZ-WYMPLXKRSA-N |
| XLogP | 4.12 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|