C23H23ClN2O5 — CID 92658239
ethyl 2-chloro-5-[5-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 92658239) has the molecular formula C23H23ClN2O5 and a molecular weight of 442.90 g/mol. Its IUPAC name is ethyl 2-chloro-5-[5-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 2-chloro-5-[5-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 92658239 |
| Molecular Formula | C23H23ClN2O5 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | ethyl 2-chloro-5-[5-[(Z)-[(3,4-dimethoxyphenyl)methylhydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cc(-c2ccc(/C=N\NCc3ccc(OC)c(OC)c3)o2)ccc1Cl |
| InChI | InChI=1S/C23H23ClN2O5/c1-4-30-23(27)18-12-16(6-8-19(18)24)20-10-7-17(31-20)14-26-25-13-15-5-9-21(28-2)22(11-15)29-3/h5-12,14,25H,4,13H2,1-3H3/b26-14- |
| InChIKey | HIVRJBUCTWEYIV-WGARJPEWSA-N |
| XLogP | 4.92 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|