C17H13ClN2O3S — CID 4268218
ethyl 5-[5-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)furan-2-yl]-2-chlorobenzoate (PubChem CID 4268218) has the molecular formula C17H13ClN2O3S and a molecular weight of 360.82 g/mol. Its IUPAC name is ethyl 5-[5-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)furan-2-yl]-2-chlorobenzoate.
| Compound Name | ethyl 5-[5-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 4268218 |
| Molecular Formula | C17H13ClN2O3S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | ethyl 5-[5-(3-amino-2-cyano-3-sulfanylideneprop-1-enyl)furan-2-yl]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1cc(-c2ccc(C=C(C#N)C(N)=S)o2)ccc1Cl |
| InChI | InChI=1S/C17H13ClN2O3S/c1-2-22-17(21)13-8-10(3-5-14(13)18)15-6-4-12(23-15)7-11(9-19)16(20)24/h3-8H,2H2,1H3,(H2,20,24) |
| InChIKey | YATGMHDILOKTRR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|