C25H14Cl2N4O3 — CID 50886202
(2-chlorophenyl)methyl 5-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 50886202) has the molecular formula C25H14Cl2N4O3 and a molecular weight of 489.32 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 5-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]-2-chlorobenzoate.
| Compound Name | (2-chlorophenyl)methyl 5-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 50886202 |
| Molecular Formula | C25H14Cl2N4O3 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | (2-chlorophenyl)methyl 5-[5-[(1Z)-3-amino-2,4,4-tricyanobuta-1,3-dienyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | N#CC(C#N)=C(N)/C(C#N)=C/c1ccc(-c2ccc(Cl)c(C(=O)OCc3ccccc3Cl)c2)o1 |
| InChI | InChI=1S/C25H14Cl2N4O3/c26-21-4-2-1-3-16(21)14-33-25(32)20-10-15(5-7-22(20)27)23-8-6-19(34-23)9-17(11-28)24(31)18(12-29)13-30/h1-10H,14,31H2/b17-9+ |
| InChIKey | AJSSDQMDYJVPLV-RQZCQDPDSA-N |
| XLogP | 5.78 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|