C19H15ClN2O3 — CID 50884678
2-methylpropyl 2-chloro-5-[5-(2,2-dicyanoethenyl)furan-2-yl]benzoate (PubChem CID 50884678) has the molecular formula C19H15ClN2O3 and a molecular weight of 354.79 g/mol. Its IUPAC name is 2-methylpropyl 2-chloro-5-[5-(2,2-dicyanoethenyl)furan-2-yl]benzoate.
| Compound Name | 2-methylpropyl 2-chloro-5-[5-(2,2-dicyanoethenyl)furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50884678 |
| Molecular Formula | C19H15ClN2O3 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-methylpropyl 2-chloro-5-[5-(2,2-dicyanoethenyl)furan-2-yl]benzoate |
| SMILES | CC(C)COC(=O)c1cc(-c2ccc(C=C(C#N)C#N)o2)ccc1Cl |
| InChI | InChI=1S/C19H15ClN2O3/c1-12(2)11-24-19(23)16-8-14(3-5-17(16)20)18-6-4-15(25-18)7-13(9-21)10-22/h3-8,12H,11H2,1-2H3 |
| InChIKey | MQRVXQMBUNWUIK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 87.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|