C16H11ClN2O4 — CID 630273
methyl 5-[5-(3-amino-2-cyano-3-oxoprop-1-enyl)furan-2-yl]-2-chlorobenzoate (PubChem CID 630273) has the molecular formula C16H11ClN2O4 and a molecular weight of 330.73 g/mol. Its IUPAC name is methyl 5-[5-(3-amino-2-cyano-3-oxoprop-1-enyl)furan-2-yl]-2-chlorobenzoate.
| Compound Name | methyl 5-[5-(3-amino-2-cyano-3-oxoprop-1-enyl)furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 630273 |
| Molecular Formula | C16H11ClN2O4 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | methyl 5-[5-(3-amino-2-cyano-3-oxoprop-1-enyl)furan-2-yl]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(-c2ccc(C=C(C#N)C(N)=O)o2)ccc1Cl |
| InChI | InChI=1S/C16H11ClN2O4/c1-22-16(21)12-7-9(2-4-13(12)17)14-5-3-11(23-14)6-10(8-18)15(19)20/h2-7H,1H3,(H2,19,20) |
| InChIKey | PVCYOFKHQWILHY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|