C22H20ClNO4 — CID 50884609
2-methylpropyl 2-chloro-5-[5-[(4-hydroxyphenyl)iminomethyl]furan-2-yl]benzoate (PubChem CID 50884609) has the molecular formula C22H20ClNO4 and a molecular weight of 397.86 g/mol. Its IUPAC name is 2-methylpropyl 2-chloro-5-[5-[(4-hydroxyphenyl)iminomethyl]furan-2-yl]benzoate.
| Compound Name | 2-methylpropyl 2-chloro-5-[5-[(4-hydroxyphenyl)iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50884609 |
| Molecular Formula | C22H20ClNO4 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-methylpropyl 2-chloro-5-[5-[(4-hydroxyphenyl)iminomethyl]furan-2-yl]benzoate |
| SMILES | CC(C)COC(=O)c1cc(-c2ccc(/C=N/c3ccc(O)cc3)o2)ccc1Cl |
| InChI | InChI=1S/C22H20ClNO4/c1-14(2)13-27-22(26)19-11-15(3-9-20(19)23)21-10-8-18(28-21)12-24-16-4-6-17(25)7-5-16/h3-12,14,25H,13H2,1-2H3/b24-12+ |
| InChIKey | UDHIUVKKQFICKK-WYMPLXKRSA-N |
| XLogP | 5.87 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|