C16H13ClN6O3 — CID 53206460
prop-2-enyl 5-[5-[(E)-(5-aminotetrazol-1-yl)iminomethyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 53206460) has the molecular formula C16H13ClN6O3 and a molecular weight of 372.77 g/mol. Its IUPAC name is prop-2-enyl 5-[5-[(E)-(5-aminotetrazol-1-yl)iminomethyl]furan-2-yl]-2-chlorobenzoate.
| Compound Name | prop-2-enyl 5-[5-[(E)-(5-aminotetrazol-1-yl)iminomethyl]furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 53206460 |
| Molecular Formula | C16H13ClN6O3 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | prop-2-enyl 5-[5-[(E)-(5-aminotetrazol-1-yl)iminomethyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | C=CCOC(=O)c1cc(-c2ccc(/C=N/n3nnnc3N)o2)ccc1Cl |
| InChI | InChI=1S/C16H13ClN6O3/c1-2-7-25-15(24)12-8-10(3-5-13(12)17)14-6-4-11(26-14)9-19-23-16(18)20-21-22-23/h2-6,8-9H,1,7H2,(H2,18,20,22)/b19-9+ |
| InChIKey | ORRYPJRFIHHPTM-DJKKODMXSA-N |
| XLogP | 2.39 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|