C12H8Cl2N6O — CID 5392571
1-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]tetrazol-5-amine (PubChem CID 5392571) has the molecular formula C12H8Cl2N6O and a molecular weight of 323.14 g/mol. Its IUPAC name is 1-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]tetrazol-5-amine.
| Compound Name | 1-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]tetrazol-5-amine |
|---|---|
| PubChem CID | 5392571 |
| Molecular Formula | C12H8Cl2N6O |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 1-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]tetrazol-5-amine |
| SMILES | Nc1nnnn1/N=C\c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C12H8Cl2N6O/c13-9-3-1-2-8(11(9)14)10-5-4-7(21-10)6-16-20-12(15)17-18-19-20/h1-6H,(H2,15,17,19)/b16-6- |
| InChIKey | BXOHIGHLBBYWFQ-SOFYXZRVSA-N |
| XLogP | 2.70 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|