C17H11BrCl2N2O — CID 50886171
4-bromo-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]aniline (PubChem CID 50886171) has the molecular formula C17H11BrCl2N2O and a molecular weight of 410.10 g/mol. Its IUPAC name is 4-bromo-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]aniline.
| Compound Name | 4-bromo-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 50886171 |
| Molecular Formula | C17H11BrCl2N2O |
| Molecular Weight | 410.10 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | 4-bromo-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]aniline |
| SMILES | Clc1cccc(-c2ccc(C=NNc3ccc(Br)cc3)o2)c1Cl |
| InChI | InChI=1S/C17H11BrCl2N2O/c18-11-4-6-12(7-5-11)22-21-10-13-8-9-16(23-13)14-2-1-3-15(19)17(14)20/h1-10,22H |
| InChIKey | UQSQYTXAOXFONA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.10 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|