C19H14Cl2N2O2 — CID 19060910
N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-2-methylbenzamide (PubChem CID 19060910) has the molecular formula C19H14Cl2N2O2 and a molecular weight of 373.24 g/mol. Its IUPAC name is N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-2-methylbenzamide.
| Compound Name | N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-2-methylbenzamide |
|---|---|
| PubChem CID | 19060910 |
| Molecular Formula | C19H14Cl2N2O2 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | N-[(E)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N/N=C/c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C19H14Cl2N2O2/c1-12-5-2-3-6-14(12)19(24)23-22-11-13-9-10-17(25-13)15-7-4-8-16(20)18(15)21/h2-11H,1H3,(H,23,24)/b22-11+ |
| InChIKey | KKZOTHWWDWTGGK-SSDVNMTOSA-N |
| XLogP | 5.33 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|