C13H10Cl2N2O3 — CID 9075577
methyl N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]carbamate (PubChem CID 9075577) has the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.14 g/mol. Its IUPAC name is methyl N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 9075577 |
| Molecular Formula | C13H10Cl2N2O3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | methyl N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]carbamate |
| SMILES | COC(=O)N/N=C\c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C13H10Cl2N2O3/c1-19-13(18)17-16-7-8-5-6-11(20-8)9-3-2-4-10(14)12(9)15/h2-7H,1H3,(H,17,18)/b16-7- |
| InChIKey | VQHMEADZPZVUCL-APSNUPSMSA-N |
| XLogP | 3.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|