C19H12Cl4N2O3 — CID 5215575
2-(2,5-dichlorophenoxy)-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 5215575) has the molecular formula C19H12Cl4N2O3 and a molecular weight of 458.13 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 5215575 |
| Molecular Formula | C19H12Cl4N2O3 |
| Molecular Weight | 458.13 g/mol |
| Exact Mass | 455.96 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)NN=Cc1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C19H12Cl4N2O3/c20-11-4-6-14(21)17(8-11)27-10-18(26)25-24-9-12-5-7-16(28-12)13-2-1-3-15(22)19(13)23/h1-9H,10H2,(H,25,26) |
| InChIKey | ZGZXYQZAQAKNEO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.13 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|