C13H8Br2Cl2N2O3 — CID 3312533
N-[(4,5-dibromofuran-2-yl)methylideneamino]-2-(2,5-dichlorophenoxy)acetamide (PubChem CID 3312533) has the molecular formula C13H8Br2Cl2N2O3 and a molecular weight of 470.93 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methylideneamino]-2-(2,5-dichlorophenoxy)acetamide.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methylideneamino]-2-(2,5-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 3312533 |
| Molecular Formula | C13H8Br2Cl2N2O3 |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 467.83 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methylideneamino]-2-(2,5-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)NN=Cc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C13H8Br2Cl2N2O3/c14-9-4-8(22-13(9)15)5-18-19-12(20)6-21-11-3-7(16)1-2-10(11)17/h1-5H,6H2,(H,19,20) |
| InChIKey | ASFPETCNLRFMBU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|