C18H14Cl4N4O4 — CID 5222965
2-(2,5-dichlorophenoxy)-N-[2-[[2-(2,5-dichlorophenoxy)acetyl]hydrazinylidene]ethylideneamino]acetamide (PubChem CID 5222965) has the molecular formula C18H14Cl4N4O4 and a molecular weight of 492.15 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[2-[[2-(2,5-dichlorophenoxy)acetyl]hydrazinylidene]ethylideneamino]acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[2-[[2-(2,5-dichlorophenoxy)acetyl]hydrazinylidene]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 5222965 |
| Molecular Formula | C18H14Cl4N4O4 |
| Molecular Weight | 492.15 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[2-[[2-(2,5-dichlorophenoxy)acetyl]hydrazinylidene]ethylideneamino]acetamide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)NN=CC=NNC(=O)COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H14Cl4N4O4/c19-11-1-3-13(21)15(7-11)29-9-17(27)25-23-5-6-24-26-18(28)10-30-16-8-12(20)2-4-14(16)22/h1-8H,9-10H2,(H,25,27)(H,26,28) |
| InChIKey | VBYXTPLQNBXMQB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.15 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|