C17H14Cl4N2O4 — CID 135629464
N-[(E)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-2-(2,5-dichlorophenoxy)acetamide (PubChem CID 135629464) has the molecular formula C17H14Cl4N2O4 and a molecular weight of 452.12 g/mol. Its IUPAC name is N-[(E)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-2-(2,5-dichlorophenoxy)acetamide.
| Compound Name | N-[(E)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-2-(2,5-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 135629464 |
| Molecular Formula | C17H14Cl4N2O4 |
| Molecular Weight | 452.12 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | N-[(E)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-2-(2,5-dichlorophenoxy)acetamide |
| SMILES | CCOc1cc(Cl)c(Cl)c(/C=N/NC(=O)COc2cc(Cl)ccc2Cl)c1O |
| InChI | InChI=1S/C17H14Cl4N2O4/c1-2-26-14-6-12(20)16(21)10(17(14)25)7-22-23-15(24)8-27-13-5-9(18)3-4-11(13)19/h3-7,25H,2,8H2,1H3,(H,23,24)/b22-7+ |
| InChIKey | JQPBRHYKLBVNIK-QPJQQBGISA-N |
| XLogP | 4.93 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.12 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|