C16H15Cl2N3O3 — CID 135641587
N-[(Z)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-6-methylpyridine-3-carboxamide (PubChem CID 135641587) has the molecular formula C16H15Cl2N3O3 and a molecular weight of 368.22 g/mol. Its IUPAC name is N-[(Z)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-6-methylpyridine-3-carboxamide.
| Compound Name | N-[(Z)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 135641587 |
| Molecular Formula | C16H15Cl2N3O3 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | N-[(Z)-(2,3-dichloro-5-ethoxy-6-hydroxyphenyl)methylideneamino]-6-methylpyridine-3-carboxamide |
| SMILES | CCOc1cc(Cl)c(Cl)c(/C=N\NC(=O)c2ccc(C)nc2)c1O |
| InChI | InChI=1S/C16H15Cl2N3O3/c1-3-24-13-6-12(17)14(18)11(15(13)22)8-20-21-16(23)10-5-4-9(2)19-7-10/h4-8,22H,3H2,1-2H3,(H,21,23)/b20-8- |
| InChIKey | MZDPIVBYAUHHQE-ZBKNUEDVSA-N |
| XLogP | 3.57 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|