C15H13Br2N3O3 — CID 135578986
N-[(E)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]-6-methylpyridine-3-carboxamide (PubChem CID 135578986) has the molecular formula C15H13Br2N3O3 and a molecular weight of 443.10 g/mol. Its IUPAC name is N-[(E)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]-6-methylpyridine-3-carboxamide.
| Compound Name | N-[(E)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 135578986 |
| Molecular Formula | C15H13Br2N3O3 |
| Molecular Weight | 443.10 g/mol |
| Exact Mass | 440.93 |
| IUPAC Name | N-[(E)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]-6-methylpyridine-3-carboxamide |
| SMILES | COc1cc(Br)c(Br)c(/C=N/NC(=O)c2ccc(C)nc2)c1O |
| InChI | InChI=1S/C15H13Br2N3O3/c1-8-3-4-9(6-18-8)15(22)20-19-7-10-13(17)11(16)5-12(23-2)14(10)21/h3-7,21H,1-2H3,(H,20,22)/b19-7+ |
| InChIKey | OEKBQDSIAVNHRJ-FBCYGCLPSA-N |
| XLogP | 3.39 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.10 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|