C13H16Br2N2O4 — CID 135642273
tert-butyl N-[(E)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]carbamate (PubChem CID 135642273) has the molecular formula C13H16Br2N2O4 and a molecular weight of 424.09 g/mol. Its IUPAC name is tert-butyl N-[(E)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 135642273 |
| Molecular Formula | C13H16Br2N2O4 |
| Molecular Weight | 424.09 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | tert-butyl N-[(E)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]carbamate |
| SMILES | COc1cc(Br)c(Br)c(/C=N/NC(=O)OC(C)(C)C)c1O |
| InChI | InChI=1S/C13H16Br2N2O4/c1-13(2,3)21-12(19)17-16-6-7-10(15)8(14)5-9(20-4)11(7)18/h5-6,18H,1-4H3,(H,17,19)/b16-6+ |
| InChIKey | IYQVVLUDPMSPGH-OMCISZLKSA-N |
| XLogP | 3.78 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.09 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|