C10H10Br2N2O4 — CID 136747503
methyl N-[(Z)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]carbamate (PubChem CID 136747503) has the molecular formula C10H10Br2N2O4 and a molecular weight of 382.01 g/mol. Its IUPAC name is methyl N-[(Z)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 136747503 |
| Molecular Formula | C10H10Br2N2O4 |
| Molecular Weight | 382.01 g/mol |
| Exact Mass | 379.90 |
| IUPAC Name | methyl N-[(Z)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]carbamate |
| SMILES | COC(=O)N/N=C\c1c(O)c(OC)cc(Br)c1Br |
| InChI | InChI=1S/C10H10Br2N2O4/c1-17-7-3-6(11)8(12)5(9(7)15)4-13-14-10(16)18-2/h3-4,15H,1-2H3,(H,14,16)/b13-4- |
| InChIKey | OVLJYXGADAJNDX-PQMHYQBVSA-N |
| XLogP | 2.62 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.01 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|