C26H24Br2N4O4 — CID 135648616
N-[(Z)-3-[(2E)-2-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 135648616) has the molecular formula C26H24Br2N4O4 and a molecular weight of 616.31 g/mol. Its IUPAC name is N-[(Z)-3-[(2E)-2-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2E)-2-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 135648616 |
| Molecular Formula | C26H24Br2N4O4 |
| Molecular Weight | 616.31 g/mol |
| Exact Mass | 614.02 |
| IUPAC Name | N-[(Z)-3-[(2E)-2-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(Br)c(Br)c(/C=N/NC(=O)/C(=C/c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C26H24Br2N4O4/c1-32(2)18-11-9-16(10-12-18)13-21(30-25(34)17-7-5-4-6-8-17)26(35)31-29-15-19-23(28)20(27)14-22(36-3)24(19)33/h4-15,33H,1-3H3,(H,30,34)(H,31,35)/b21-13-,29-15+ |
| InChIKey | LOAQXKNNNSBKDM-PKBRHQBWSA-N |
| XLogP | 4.91 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|