C28H27Br2ClN4O4 — CID 5190656
2-chloro-N-[3-[2-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 5190656) has the molecular formula C28H27Br2ClN4O4 and a molecular weight of 678.81 g/mol. Its IUPAC name is 2-chloro-N-[3-[2-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2-chloro-N-[3-[2-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 5190656 |
| Molecular Formula | C28H27Br2ClN4O4 |
| Molecular Weight | 678.81 g/mol |
| Exact Mass | 676.01 |
| IUPAC Name | 2-chloro-N-[3-[2-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCN(CC)c1ccc(C=C(NC(=O)c2ccccc2Cl)C(=O)NN=Cc2c(O)c(OC)cc(Br)c2Br)cc1 |
| InChI | InChI=1S/C28H27Br2ClN4O4/c1-4-35(5-2)18-12-10-17(11-13-18)14-23(33-27(37)19-8-6-7-9-22(19)31)28(38)34-32-16-20-25(30)21(29)15-24(39-3)26(20)36/h6-16,36H,4-5H2,1-3H3,(H,33,37)(H,34,38) |
| InChIKey | DFVNHPGNPMSIDX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.81 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|