C29H29ClN4O5 — CID 5003269
2-[2-[[[2-[(2-chlorobenzoyl)amino]-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 5003269) has the molecular formula C29H29ClN4O5 and a molecular weight of 549.03 g/mol. Its IUPAC name is 2-[2-[[[2-[(2-chlorobenzoyl)amino]-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[[2-[(2-chlorobenzoyl)amino]-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 5003269 |
| Molecular Formula | C29H29ClN4O5 |
| Molecular Weight | 549.03 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 2-[2-[[[2-[(2-chlorobenzoyl)amino]-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CCN(CC)c1ccc(C=C(NC(=O)c2ccccc2Cl)C(=O)NN=Cc2ccccc2OCC(=O)O)cc1 |
| InChI | InChI=1S/C29H29ClN4O5/c1-3-34(4-2)22-15-13-20(14-16-22)17-25(32-28(37)23-10-6-7-11-24(23)30)29(38)33-31-18-21-9-5-8-12-26(21)39-19-27(35)36/h5-18H,3-4,19H2,1-2H3,(H,32,37)(H,33,38)(H,35,36) |
| InChIKey | MMAFXBAPGMUFBG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.03 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|