C38H39ClN4O8 — CID 3732500
[4-[[[2-[(2-chlorobenzoyl)amino]-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate (PubChem CID 3732500) has the molecular formula C38H39ClN4O8 and a molecular weight of 715.20 g/mol. Its IUPAC name is [4-[[[2-[(2-chlorobenzoyl)amino]-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[[[2-[(2-chlorobenzoyl)amino]-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3732500 |
| Molecular Formula | C38H39ClN4O8 |
| Molecular Weight | 715.20 g/mol |
| Exact Mass | 714.25 |
| IUPAC Name | [4-[[[2-[(2-chlorobenzoyl)amino]-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCN(CC)c1ccc(C=C(NC(=O)c2ccccc2Cl)C(=O)NN=Cc2ccc(OC(=O)c3cc(OC)c(OC)c(OC)c3)c(OC)c2)cc1 |
| InChI | InChI=1S/C38H39ClN4O8/c1-7-43(8-2)27-16-13-24(14-17-27)19-30(41-36(44)28-11-9-10-12-29(28)39)37(45)42-40-23-25-15-18-31(32(20-25)47-3)51-38(46)26-21-33(48-4)35(50-6)34(22-26)49-5/h9-23H,7-8H2,1-6H3,(H,41,44)(H,42,45) |
| InChIKey | YHUZUICTYOJELO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.20 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|