C35H34N4O7 — CID 3337054
[3-[[[2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 3337054) has the molecular formula C35H34N4O7 and a molecular weight of 622.68 g/mol. Its IUPAC name is [3-[[[2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [3-[[[2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3337054 |
| Molecular Formula | C35H34N4O7 |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | [3-[[[2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2cccc(C=NNC(=O)C(=Cc3ccc(N(C)C)cc3)NC(=O)c3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C35H34N4O7/c1-39(2)27-16-14-23(15-17-27)19-29(37-33(40)25-11-7-6-8-12-25)34(41)38-36-22-24-10-9-13-28(18-24)46-35(42)26-20-30(43-3)32(45-5)31(21-26)44-4/h6-22H,1-5H3,(H,37,40)(H,38,41) |
| InChIKey | CWNZLUYJKRUTQF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|