C32H27BrN4O4 — CID 43907125
[4-[(E)-[[(Z)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate (PubChem CID 43907125) has the molecular formula C32H27BrN4O4 and a molecular weight of 611.50 g/mol. Its IUPAC name is [4-[(E)-[[(Z)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate.
| Compound Name | [4-[(E)-[[(Z)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 43907125 |
| Molecular Formula | C32H27BrN4O4 |
| Molecular Weight | 611.50 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | [4-[(E)-[[(Z)-2-benzamido-3-[4-(dimethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
| SMILES | CN(C)c1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)N/N=C/c2ccc(OC(=O)c3ccccc3Br)cc2)cc1 |
| InChI | InChI=1S/C32H27BrN4O4/c1-37(2)25-16-12-22(13-17-25)20-29(35-30(38)24-8-4-3-5-9-24)31(39)36-34-21-23-14-18-26(19-15-23)41-32(40)27-10-6-7-11-28(27)33/h3-21H,1-2H3,(H,35,38)(H,36,39)/b29-20-,34-21+ |
| InChIKey | PHQJRGJHOZUXFT-ZDQDAFGJSA-N |
| XLogP | 5.66 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|