C23H20Br2N4O3 — CID 3249604
N-[3-[2-[(4,5-dibromofuran-2-yl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 3249604) has the molecular formula C23H20Br2N4O3 and a molecular weight of 560.25 g/mol. Its IUPAC name is N-[3-[2-[(4,5-dibromofuran-2-yl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-[(4,5-dibromofuran-2-yl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3249604 |
| Molecular Formula | C23H20Br2N4O3 |
| Molecular Weight | 560.25 g/mol |
| Exact Mass | 557.99 |
| IUPAC Name | N-[3-[2-[(4,5-dibromofuran-2-yl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN(C)c1ccc(C=C(NC(=O)c2ccccc2)C(=O)NN=Cc2cc(Br)c(Br)o2)cc1 |
| InChI | InChI=1S/C23H20Br2N4O3/c1-29(2)17-10-8-15(9-11-17)12-20(27-22(30)16-6-4-3-5-7-16)23(31)28-26-14-18-13-19(24)21(25)32-18/h3-14H,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | OPYMVOUNKRYWFW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.25 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|