C21H15Br2N3O3 — CID 5335415
N-[(Z)-3-[(2E)-2-[(4,5-dibromofuran-2-yl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 5335415) has the molecular formula C21H15Br2N3O3 and a molecular weight of 517.18 g/mol. Its IUPAC name is N-[(Z)-3-[(2E)-2-[(4,5-dibromofuran-2-yl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2E)-2-[(4,5-dibromofuran-2-yl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 5335415 |
| Molecular Formula | C21H15Br2N3O3 |
| Molecular Weight | 517.18 g/mol |
| Exact Mass | 514.95 |
| IUPAC Name | N-[(Z)-3-[(2E)-2-[(4,5-dibromofuran-2-yl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | O=C(N/N=C/c1cc(Br)c(Br)o1)/C(=C/c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H15Br2N3O3/c22-17-12-16(29-19(17)23)13-24-26-21(28)18(11-14-7-3-1-4-8-14)25-20(27)15-9-5-2-6-10-15/h1-13H,(H,25,27)(H,26,28)/b18-11-,24-13+ |
| InChIKey | QLZSGCQKUQESNO-CECYVXGQSA-N |
| XLogP | 4.73 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.18 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|