C21H15BrN4O5 — CID 2858424
N-[3-[2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 2858424) has the molecular formula C21H15BrN4O5 and a molecular weight of 483.28 g/mol. Its IUPAC name is N-[3-[2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 2858424 |
| Molecular Formula | C21H15BrN4O5 |
| Molecular Weight | 483.28 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | N-[3-[2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NN=Cc1ccc(Br)o1)C(=Cc1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H15BrN4O5/c22-19-11-10-17(31-19)13-23-25-21(28)18(24-20(27)15-4-2-1-3-5-15)12-14-6-8-16(9-7-14)26(29)30/h1-13H,(H,24,27)(H,25,28) |
| InChIKey | UVIFERAYLTZJQN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|