C21H16IN3O3 — CID 4695651
N-[3-[2-[(5-iodofuran-2-yl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 4695651) has the molecular formula C21H16IN3O3 and a molecular weight of 485.28 g/mol. Its IUPAC name is N-[3-[2-[(5-iodofuran-2-yl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-[(5-iodofuran-2-yl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 4695651 |
| Molecular Formula | C21H16IN3O3 |
| Molecular Weight | 485.28 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | N-[3-[2-[(5-iodofuran-2-yl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | O=C(NN=Cc1ccc(I)o1)C(=Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H16IN3O3/c22-19-12-11-17(28-19)14-23-25-21(27)18(13-15-7-3-1-4-8-15)24-20(26)16-9-5-2-6-10-16/h1-14H,(H,24,26)(H,25,27) |
| InChIKey | NRNXHGYERHMZIY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|