C23H16ClFN4O4 — CID 26367994
N-[(Z)-3-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 26367994) has the molecular formula C23H16ClFN4O4 and a molecular weight of 466.86 g/mol. Its IUPAC name is N-[(Z)-3-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 26367994 |
| Molecular Formula | C23H16ClFN4O4 |
| Molecular Weight | 466.86 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | N-[(Z)-3-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(N/N=C\c1c(F)cccc1Cl)/C(=C/c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H16ClFN4O4/c24-19-7-4-8-20(25)18(19)14-26-28-23(31)21(27-22(30)16-5-2-1-3-6-16)13-15-9-11-17(12-10-15)29(32)33/h1-14H,(H,27,30)(H,28,31)/b21-13-,26-14- |
| InChIKey | QCRVENHDSQUIJI-ZCTVNCNJSA-N |
| XLogP | 4.31 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|