C25H22BrN3O4 — CID 137206909
N-[(Z)-3-[2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 137206909) has the molecular formula C25H22BrN3O4 and a molecular weight of 508.37 g/mol. Its IUPAC name is N-[(Z)-3-[2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 137206909 |
| Molecular Formula | C25H22BrN3O4 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | N-[(Z)-3-[2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | CCOc1cc(Br)cc(C=NNC(=O)/C(=C/c2ccccc2)NC(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C25H22BrN3O4/c1-2-33-22-15-20(26)14-19(23(22)30)16-27-29-25(32)21(13-17-9-5-3-6-10-17)28-24(31)18-11-7-4-8-12-18/h3-16,30H,2H2,1H3,(H,28,31)(H,29,32)/b21-13-,27-16? |
| InChIKey | LDLQUUJSJJYUHN-CGVQZEPTSA-N |
| XLogP | 4.47 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|