C27H27IN4O4 — CID 136737952
N-[(E)-1-[4-(dimethylamino)phenyl]-3-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 136737952) has the molecular formula C27H27IN4O4 and a molecular weight of 598.44 g/mol. Its IUPAC name is N-[(E)-1-[4-(dimethylamino)phenyl]-3-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 136737952 |
| Molecular Formula | C27H27IN4O4 |
| Molecular Weight | 598.44 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)/C(=C\c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)cc(I)c1O |
| InChI | InChI=1S/C27H27IN4O4/c1-4-36-24-16-19(14-22(28)25(24)33)17-29-31-27(35)23(30-26(34)20-8-6-5-7-9-20)15-18-10-12-21(13-11-18)32(2)3/h5-17,33H,4H2,1-3H3,(H,30,34)(H,31,35)/b23-15+,29-17- |
| InChIKey | QHXUYQLSTGMSQN-UFMPEYACSA-N |
| XLogP | 4.38 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|