C27H26BrClN4O4 — CID 135613505
N-[3-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-2-chlorobenzamide (PubChem CID 135613505) has the molecular formula C27H26BrClN4O4 and a molecular weight of 585.89 g/mol. Its IUPAC name is N-[3-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-2-chlorobenzamide.
| Compound Name | N-[3-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 135613505 |
| Molecular Formula | C27H26BrClN4O4 |
| Molecular Weight | 585.89 g/mol |
| Exact Mass | 584.08 |
| IUPAC Name | N-[3-[(2E)-2-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]hydrazinyl]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]-2-chlorobenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(=Cc2ccc(N(C)C)cc2)NC(=O)c2ccccc2Cl)cc(Br)c1O |
| InChI | InChI=1S/C27H26BrClN4O4/c1-4-37-24-15-18(13-21(28)25(24)34)16-30-32-27(36)23(14-17-9-11-19(12-10-17)33(2)3)31-26(35)20-7-5-6-8-22(20)29/h5-16,34H,4H2,1-3H3,(H,31,35)(H,32,36)/b23-14?,30-16+ |
| InChIKey | IYSLIYQDUQZFOK-FIYGXFRDSA-N |
| XLogP | 5.19 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.89 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|