C27H26Br2N4O3 — CID 137231556
N-[(E)-3-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 137231556) has the molecular formula C27H26Br2N4O3 and a molecular weight of 614.34 g/mol. Its IUPAC name is N-[(E)-3-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 137231556 |
| Molecular Formula | C27H26Br2N4O3 |
| Molecular Weight | 614.34 g/mol |
| Exact Mass | 612.04 |
| IUPAC Name | N-[(E)-3-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCN(CC)c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)NN=Cc2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C27H26Br2N4O3/c1-3-33(4-2)22-12-10-18(11-13-22)14-24(31-26(35)19-8-6-5-7-9-19)27(36)32-30-17-20-15-21(28)16-23(29)25(20)34/h5-17,34H,3-4H2,1-2H3,(H,31,35)(H,32,36)/b24-14+,30-17? |
| InChIKey | XASWKCZDOYGMIV-WBYXHGIYSA-N |
| XLogP | 5.68 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.34 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|