C29H29BrN4O2 — CID 129438554
N-[(E)-3-[2-[(E)-2-bromo-3-phenylprop-2-enylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 129438554) has the molecular formula C29H29BrN4O2 and a molecular weight of 545.48 g/mol. Its IUPAC name is N-[(E)-3-[2-[(E)-2-bromo-3-phenylprop-2-enylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[2-[(E)-2-bromo-3-phenylprop-2-enylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 129438554 |
| Molecular Formula | C29H29BrN4O2 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | N-[(E)-3-[2-[(E)-2-bromo-3-phenylprop-2-enylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCN(CC)c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)NN=C/C(Br)=C\c2ccccc2)cc1 |
| InChI | InChI=1S/C29H29BrN4O2/c1-3-34(4-2)26-17-15-23(16-18-26)20-27(32-28(35)24-13-9-6-10-14-24)29(36)33-31-21-25(30)19-22-11-7-5-8-12-22/h5-21H,3-4H2,1-2H3,(H,32,35)(H,33,36)/b25-19+,27-20+,31-21? |
| InChIKey | GZYJQDOVYJGLBX-OQFPSYQZSA-N |
| XLogP | 5.84 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|