C29H32N4O4 — CID 4020669
N-[1-[4-(diethylamino)phenyl]-3-[2-[(2,4-dihydroxy-3,6-dimethylphenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 4020669) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is N-[1-[4-(diethylamino)phenyl]-3-[2-[(2,4-dihydroxy-3,6-dimethylphenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-[4-(diethylamino)phenyl]-3-[2-[(2,4-dihydroxy-3,6-dimethylphenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 4020669 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | N-[1-[4-(diethylamino)phenyl]-3-[2-[(2,4-dihydroxy-3,6-dimethylphenyl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCN(CC)c1ccc(C=C(NC(=O)c2ccccc2)C(=O)NN=Cc2c(C)cc(O)c(C)c2O)cc1 |
| InChI | InChI=1S/C29H32N4O4/c1-5-33(6-2)23-14-12-21(13-15-23)17-25(31-28(36)22-10-8-7-9-11-22)29(37)32-30-18-24-19(3)16-26(34)20(4)27(24)35/h7-18,34-35H,5-6H2,1-4H3,(H,31,36)(H,32,37) |
| InChIKey | BMUXBGHBIAXMBH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|