C27H26BrN5O4 — CID 5205569
N-[3-[2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 5205569) has the molecular formula C27H26BrN5O4 and a molecular weight of 564.44 g/mol. Its IUPAC name is N-[3-[2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 5205569 |
| Molecular Formula | C27H26BrN5O4 |
| Molecular Weight | 564.44 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | N-[3-[2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-1-[4-(diethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCN(CC)c1ccc(C=C(NC(=O)c2ccccc2)C(=O)NN=Cc2ccc(Br)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C27H26BrN5O4/c1-3-32(4-2)22-13-10-19(11-14-22)16-24(30-26(34)21-8-6-5-7-9-21)27(35)31-29-18-20-12-15-23(28)25(17-20)33(36)37/h5-18H,3-4H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | INPLUNUPIFVKPZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|