C34H31N5O6 — CID 7074013
[3-[(Z)-[[(Z)-2-benzamido-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 7074013) has the molecular formula C34H31N5O6 and a molecular weight of 605.65 g/mol. Its IUPAC name is [3-[(Z)-[[(Z)-2-benzamido-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [3-[(Z)-[[(Z)-2-benzamido-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 7074013 |
| Molecular Formula | C34H31N5O6 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | [3-[(Z)-[[(Z)-2-benzamido-3-[4-(diethylamino)phenyl]prop-2-enoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | CCN(CC)c1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)N/N=C\c2cccc(OC(=O)c3ccc([N+](=O)[O-])cc3)c2)cc1 |
| InChI | InChI=1S/C34H31N5O6/c1-3-38(4-2)28-17-13-24(14-18-28)22-31(36-32(40)26-10-6-5-7-11-26)33(41)37-35-23-25-9-8-12-30(21-25)45-34(42)27-15-19-29(20-16-27)39(43)44/h5-23H,3-4H2,1-2H3,(H,36,40)(H,37,41)/b31-22-,35-23- |
| InChIKey | MNZUESFCFHVYIX-MMKQMQFESA-N |
| XLogP | 5.58 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|