C30H32N4O2 — CID 46502615
N-[(E)-1-[4-(diethylamino)phenyl]-3-oxo-3-[(2E)-2-[(Z)-4-phenylbut-3-en-2-ylidene]hydrazinyl]prop-1-en-2-yl]benzamide (PubChem CID 46502615) has the molecular formula C30H32N4O2 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-[(E)-1-[4-(diethylamino)phenyl]-3-oxo-3-[(2E)-2-[(Z)-4-phenylbut-3-en-2-ylidene]hydrazinyl]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-[4-(diethylamino)phenyl]-3-oxo-3-[(2E)-2-[(Z)-4-phenylbut-3-en-2-ylidene]hydrazinyl]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46502615 |
| Molecular Formula | C30H32N4O2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | N-[(E)-1-[4-(diethylamino)phenyl]-3-oxo-3-[(2E)-2-[(Z)-4-phenylbut-3-en-2-ylidene]hydrazinyl]prop-1-en-2-yl]benzamide |
| SMILES | CCN(CC)c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)N/N=C(C)/C=C\c2ccccc2)cc1 |
| InChI | InChI=1S/C30H32N4O2/c1-4-34(5-2)27-20-18-25(19-21-27)22-28(31-29(35)26-14-10-7-11-15-26)30(36)33-32-23(3)16-17-24-12-8-6-9-13-24/h6-22H,4-5H2,1-3H3,(H,31,35)(H,33,36)/b17-16-,28-22+,32-23+ |
| InChIKey | WRMYWRFCBHNNIB-YSEFUQGBSA-N |
| XLogP | 5.51 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|