C24H20BrN3O2 — CID 129440332
N-[(E)-3-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 129440332) has the molecular formula C24H20BrN3O2 and a molecular weight of 462.35 g/mol. Its IUPAC name is N-[(E)-3-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 129440332 |
| Molecular Formula | C24H20BrN3O2 |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | N-[(E)-3-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | CC(=NNC(=O)/C(=C\c1ccccc1)NC(=O)c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C24H20BrN3O2/c1-17(20-13-8-14-21(25)16-20)27-28-24(30)22(15-18-9-4-2-5-10-18)26-23(29)19-11-6-3-7-12-19/h2-16H,1H3,(H,26,29)(H,28,30)/b22-15+,27-17? |
| InChIKey | RXTAQVIXFUPAJR-IXKTZPFVSA-N |
| XLogP | 4.76 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|