C27H25N3O3 — CID 135833946
N-[(2Z,4E)-1-[(2E)-2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-4-methyl-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 135833946) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[(2Z,4E)-1-[(2E)-2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-4-methyl-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[(2Z,4E)-1-[(2E)-2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-4-methyl-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 135833946 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[(2Z,4E)-1-[(2E)-2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-4-methyl-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | CC(/C=C(\NC(=O)c1ccccc1)C(=O)N/N=C(\C)c1ccc(O)cc1)=C\c1ccccc1 |
| InChI | InChI=1S/C27H25N3O3/c1-19(17-21-9-5-3-6-10-21)18-25(28-26(32)23-11-7-4-8-12-23)27(33)30-29-20(2)22-13-15-24(31)16-14-22/h3-18,31H,1-2H3,(H,28,32)(H,30,33)/b19-17+,25-18-,29-20+ |
| InChIKey | NRCONHIAHYHNKB-FBOYWDSYSA-N |
| XLogP | 4.65 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|