C25H20BrN3O4 — CID 4006375
N-[1-(1,3-benzodioxol-5-yl)-3-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 4006375) has the molecular formula C25H20BrN3O4 and a molecular weight of 506.36 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)-3-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)-3-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 4006375 |
| Molecular Formula | C25H20BrN3O4 |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)-3-[2-[1-(3-bromophenyl)ethylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(=NNC(=O)C(=Cc1ccc2c(c1)OCO2)NC(=O)c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C25H20BrN3O4/c1-16(19-8-5-9-20(26)14-19)28-29-25(31)21(27-24(30)18-6-3-2-4-7-18)12-17-10-11-22-23(13-17)33-15-32-22/h2-14H,15H2,1H3,(H,27,30)(H,29,31) |
| InChIKey | FFXAXUZMHLXKJD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|