C25H20N4O8 — CID 135545688
N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[1-(2,4-dihydroxy-5-nitrophenyl)ethylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 135545688) has the molecular formula C25H20N4O8 and a molecular weight of 504.46 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[1-(2,4-dihydroxy-5-nitrophenyl)ethylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[1-(2,4-dihydroxy-5-nitrophenyl)ethylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 135545688 |
| Molecular Formula | C25H20N4O8 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[1-(2,4-dihydroxy-5-nitrophenyl)ethylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | C/C(=N/NC(=O)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccccc1)c1cc([N+](=O)[O-])c(O)cc1O |
| InChI | InChI=1S/C25H20N4O8/c1-14(17-11-19(29(34)35)21(31)12-20(17)30)27-28-25(33)18(26-24(32)16-5-3-2-4-6-16)9-15-7-8-22-23(10-15)37-13-36-22/h2-12,30-31H,13H2,1H3,(H,26,32)(H,28,33)/b18-9-,27-14- |
| InChIKey | GZKBUDGREFUKBW-QAUKTNKXSA-N |
| XLogP | 3.05 |
| TPSA | 172.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|