C24H19N5O8 — CID 5000840
N-[3-[2-[1-(2,4-dihydroxy-5-nitrophenyl)ethylidene]hydrazinyl]-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 5000840) has the molecular formula C24H19N5O8 and a molecular weight of 505.44 g/mol. Its IUPAC name is N-[3-[2-[1-(2,4-dihydroxy-5-nitrophenyl)ethylidene]hydrazinyl]-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[2-[1-(2,4-dihydroxy-5-nitrophenyl)ethylidene]hydrazinyl]-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 5000840 |
| Molecular Formula | C24H19N5O8 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | N-[3-[2-[1-(2,4-dihydroxy-5-nitrophenyl)ethylidene]hydrazinyl]-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(=NNC(=O)C(=Cc1cccc([N+](=O)[O-])c1)NC(=O)c1ccccc1)c1cc([N+](=O)[O-])c(O)cc1O |
| InChI | InChI=1S/C24H19N5O8/c1-14(18-12-20(29(36)37)22(31)13-21(18)30)26-27-24(33)19(25-23(32)16-7-3-2-4-8-16)11-15-6-5-9-17(10-15)28(34)35/h2-13,30-31H,1H3,(H,25,32)(H,27,33) |
| InChIKey | CLCNDTMOTMJMGE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 197.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|